C16H20O3 — CID 19872804
3,4-diethoxy-7-ethylnaphthalen-1-ol (PubChem CID 19872804) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 3,4-diethoxy-7-ethylnaphthalen-1-ol.
| Compound Name | 3,4-diethoxy-7-ethylnaphthalen-1-ol |
|---|---|
| PubChem CID | 19872804 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 3,4-diethoxy-7-ethylnaphthalen-1-ol |
| SMILES | CCOc1cc(O)c2cc(CC)ccc2c1OCC |
| InChI | InChI=1S/C16H20O3/c1-4-11-7-8-12-13(9-11)14(17)10-15(18-5-2)16(12)19-6-3/h7-10,17H,4-6H2,1-3H3 |
| InChIKey | WJLBQBXBKGMAJA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |