About 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol
2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol (PubChem CID 19876800) has the molecular formula C11H13N3O
and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol |
| PubChem CID | 19876800 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol |
| SMILES | OCCN1CCn2c1nc1ccccc12 |
| InChI | InChI=1S/C11H13N3O/c15-8-7-13-5-6-14-10-4-2-1-3-9(10)12-11(13)14/h1-4,15H,5-8H2 |
| InChIKey | HAPRVLGHXCAALW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol?
The IUPAC name of 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol (CID 19876800) is 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol.
What is the SMILES notation for 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol?
The canonical SMILES for 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol is OCCN1CCn2c1nc1ccccc12.
What is the InChIKey of 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol?
The InChIKey is HAPRVLGHXCAALW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O/c15-8-7-13-5-6-14-10-4-2-1-3-9(10)12-11(13)14/h1-4,15H,5-8H2.
What are the key properties of 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol?
2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol has a molecular weight of 203.25 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol is sourced from PubChem (CID 19876800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).