C11H13N3O — CID 19876800
2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol (PubChem CID 19876800) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol.
| Compound Name | 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol |
|---|---|
| PubChem CID | 19876800 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)ethanol |
| SMILES | OCCN1CCn2c1nc1ccccc12 |
| InChI | InChI=1S/C11H13N3O/c15-8-7-13-5-6-14-10-4-2-1-3-9(10)12-11(13)14/h1-4,15H,5-8H2 |
| InChIKey | HAPRVLGHXCAALW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |