C30H40O6 — CID 19877306
ethyl 5-hydroxy-3-oxo-7-(2,2,4-trimethyl-5-phenylmethoxy-6-propan-2-yl-3H-1-benzofuran-7-yl)heptanoate (PubChem CID 19877306) has the molecular formula C30H40O6 and a molecular weight of 496.64 g/mol. Its IUPAC name is ethyl 5-hydroxy-3-oxo-7-(2,2,4-trimethyl-5-phenylmethoxy-6-propan-2-yl-3H-1-benzofuran-7-yl)heptanoate.
| Compound Name | ethyl 5-hydroxy-3-oxo-7-(2,2,4-trimethyl-5-phenylmethoxy-6-propan-2-yl-3H-1-benzofuran-7-yl)heptanoate |
|---|---|
| PubChem CID | 19877306 |
| Molecular Formula | C30H40O6 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | ethyl 5-hydroxy-3-oxo-7-(2,2,4-trimethyl-5-phenylmethoxy-6-propan-2-yl-3H-1-benzofuran-7-yl)heptanoate |
| SMILES | CCOC(=O)CC(=O)CC(O)CCc1c2c(c(C)c(OCc3ccccc3)c1C(C)C)CC(C)(C)O2 |
| InChI | InChI=1S/C30H40O6/c1-7-34-26(33)16-23(32)15-22(31)13-14-24-27(19(2)3)28(35-18-21-11-9-8-10-12-21)20(4)25-17-30(5,6)36-29(24)25/h8-12,19,22,31H,7,13-18H2,1-6H3 |
| InChIKey | LOWLYBXYRQYEHJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|