C20H37NO4P+ — CID 19879084
2-[hydroxy(4-phenylmethoxyoctoxy)phosphanyl]oxyethyl-trimethylazanium (PubChem CID 19879084) has the molecular formula C20H37NO4P+ and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-[hydroxy(4-phenylmethoxyoctoxy)phosphanyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy(4-phenylmethoxyoctoxy)phosphanyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 19879084 |
| Molecular Formula | C20H37NO4P+ |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 2-[hydroxy(4-phenylmethoxyoctoxy)phosphanyl]oxyethyl-trimethylazanium |
| SMILES | CCCCC(CCCOP(O)OCC[N+](C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C20H37NO4P/c1-5-6-13-20(23-18-19-11-8-7-9-12-19)14-10-16-24-26(22)25-17-15-21(2,3)4/h7-9,11-12,20,22H,5-6,10,13-18H2,1-4H3/q+1 |
| InChIKey | QQNLTVKSKDWTDZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|