C22H41NO5P+ — CID 19879111
2-[hydroxy-[5-[(4-methoxyphenyl)methoxy]nonoxy]phosphanyl]oxyethyl-trimethylazanium (PubChem CID 19879111) has the molecular formula C22H41NO5P+ and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-[hydroxy-[5-[(4-methoxyphenyl)methoxy]nonoxy]phosphanyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[5-[(4-methoxyphenyl)methoxy]nonoxy]phosphanyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 19879111 |
| Molecular Formula | C22H41NO5P+ |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 2-[hydroxy-[5-[(4-methoxyphenyl)methoxy]nonoxy]phosphanyl]oxyethyl-trimethylazanium |
| SMILES | CCCCC(CCCCOP(O)OCC[N+](C)(C)C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H41NO5P/c1-6-7-10-22(26-19-20-12-14-21(25-5)15-13-20)11-8-9-17-27-29(24)28-18-16-23(2,3)4/h12-15,22,24H,6-11,16-19H2,1-5H3/q+1 |
| InChIKey | WWPKOLYDEDDQCA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|