C18H13NO3S — CID 19879481
2-propan-2-ylthiochromeno[2,3-e]isoindole-1,3,6-trione (PubChem CID 19879481) has the molecular formula C18H13NO3S and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-propan-2-ylthiochromeno[2,3-e]isoindole-1,3,6-trione.
| Compound Name | 2-propan-2-ylthiochromeno[2,3-e]isoindole-1,3,6-trione |
|---|---|
| PubChem CID | 19879481 |
| Molecular Formula | C18H13NO3S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-propan-2-ylthiochromeno[2,3-e]isoindole-1,3,6-trione |
| SMILES | CC(C)N1C(=O)c2ccc3c(=O)c4ccccc4sc3c2C1=O |
| InChI | InChI=1S/C18H13NO3S/c1-9(2)19-17(21)11-7-8-12-15(20)10-5-3-4-6-13(10)23-16(12)14(11)18(19)22/h3-9H,1-2H3 |
| InChIKey | MFFQXTGQEHJMBX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|