C23H23NO3S — CID 15169481
2-octylthiochromeno[2,3-e]isoindole-1,3,6-trione (PubChem CID 15169481) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is 2-octylthiochromeno[2,3-e]isoindole-1,3,6-trione.
| Compound Name | 2-octylthiochromeno[2,3-e]isoindole-1,3,6-trione |
|---|---|
| PubChem CID | 15169481 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-octylthiochromeno[2,3-e]isoindole-1,3,6-trione |
| SMILES | CCCCCCCCN1C(=O)c2ccc3c(=O)c4ccccc4sc3c2C1=O |
| InChI | InChI=1S/C23H23NO3S/c1-2-3-4-5-6-9-14-24-22(26)16-12-13-17-20(25)15-10-7-8-11-18(15)28-21(17)19(16)23(24)27/h7-8,10-13H,2-6,9,14H2,1H3 |
| InChIKey | OELLHDRPIWKPMT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|