C17H30BrNO2 — CID 19880247
1-pyridin-1-ium-1-yldodecane-3,5-diol bromide (PubChem CID 19880247) has the molecular formula C17H30BrNO2 and a molecular weight of 360.34 g/mol. Its IUPAC name is 1-pyridin-1-ium-1-yldodecane-3,5-diol bromide.
| Compound Name | 1-pyridin-1-ium-1-yldodecane-3,5-diol bromide |
|---|---|
| PubChem CID | 19880247 |
| Molecular Formula | C17H30BrNO2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-pyridin-1-ium-1-yldodecane-3,5-diol bromide |
| SMILES | CCCCCCCC(O)CC(O)CC[n+]1ccccc1.[Br-] |
| InChI | InChI=1S/C17H30NO2.BrH/c1-2-3-4-5-7-10-16(19)15-17(20)11-14-18-12-8-6-9-13-18;/h6,8-9,12-13,16-17,19-20H,2-5,7,10-11,14-15H2,1H3;1H/q+1;/p-1 |
| InChIKey | ZDFYMSSGRVEYAL-UHFFFAOYSA-M |
| XLogP | -0.16 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|