C8H16N2O2 — CID 19883363
6,10-dioxa-2-azaspiro[4.5]decan-4-ylmethanamine (PubChem CID 19883363) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 6,10-dioxa-2-azaspiro[4.5]decan-4-ylmethanamine.
| Compound Name | 6,10-dioxa-2-azaspiro[4.5]decan-4-ylmethanamine |
|---|---|
| PubChem CID | 19883363 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 6,10-dioxa-2-azaspiro[4.5]decan-4-ylmethanamine |
| SMILES | NCC1CNCC12OCCCO2 |
| InChI | InChI=1S/C8H16N2O2/c9-4-7-5-10-6-8(7)11-2-1-3-12-8/h7,10H,1-6,9H2 |
| InChIKey | YITVBLRFOBGJHT-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |