C8H14FNO2 — CID 19883378
4-(fluoromethyl)-6,10-dioxa-2-azaspiro[4.5]decane (PubChem CID 19883378) has the molecular formula C8H14FNO2 and a molecular weight of 175.20 g/mol. Its IUPAC name is 4-(fluoromethyl)-6,10-dioxa-2-azaspiro[4.5]decane.
| Compound Name | 4-(fluoromethyl)-6,10-dioxa-2-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 19883378 |
| Molecular Formula | C8H14FNO2 |
| Molecular Weight | 175.20 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 4-(fluoromethyl)-6,10-dioxa-2-azaspiro[4.5]decane |
| SMILES | FCC1CNCC12OCCCO2 |
| InChI | InChI=1S/C8H14FNO2/c9-4-7-5-10-6-8(7)11-2-1-3-12-8/h7,10H,1-6H2 |
| InChIKey | LDTOWPODZAMRKS-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |