C16H27N — CID 19885160
4-(4-tert-butylphenyl)-N,N-dimethylbutan-2-amine (PubChem CID 19885160) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-N,N-dimethylbutan-2-amine.
| Compound Name | 4-(4-tert-butylphenyl)-N,N-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 19885160 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 4-(4-tert-butylphenyl)-N,N-dimethylbutan-2-amine |
| SMILES | CC(CCc1ccc(C(C)(C)C)cc1)N(C)C |
| InChI | InChI=1S/C16H27N/c1-13(17(5)6)7-8-14-9-11-15(12-10-14)16(2,3)4/h9-13H,7-8H2,1-6H3 |
| InChIKey | UCBFNEWMOFJOLO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |