C17H29NO — CID 19885290
N,N-dimethyl-4-[4-(3-methylbutoxy)phenyl]butan-2-amine (PubChem CID 19885290) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is N,N-dimethyl-4-[4-(3-methylbutoxy)phenyl]butan-2-amine.
| Compound Name | N,N-dimethyl-4-[4-(3-methylbutoxy)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 19885290 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | N,N-dimethyl-4-[4-(3-methylbutoxy)phenyl]butan-2-amine |
| SMILES | CC(C)CCOc1ccc(CCC(C)N(C)C)cc1 |
| InChI | InChI=1S/C17H29NO/c1-14(2)12-13-19-17-10-8-16(9-11-17)7-6-15(3)18(4)5/h8-11,14-15H,6-7,12-13H2,1-5H3 |
| InChIKey | PMYMCYDSDSRRNG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |