About 2-methyl-4-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid
2-methyl-4-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 19885541) has the molecular formula C7H6F3NO2S
and a molecular weight of 225.19 g/mol. Its IUPAC name is 2-methyl-4-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid.
Analyze 2-methyl-4-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-methyl-4-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid (CID 19885541) is 2-methyl-4-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-methyl-4-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-methyl-4-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid is Cc1nc(CC(F)(F)F)c(C(=O)O)s1.
What is the InChIKey of 2-methyl-4-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is AZBIXDSZENWILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3NO2S/c1-3-11-4(2-7(8,9)10)5(14-3)6(12)13/h2H2,1H3,(H,12,13).
What are the key properties of 2-methyl-4-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid?
2-methyl-4-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 225.19 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 19885541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).