C12H16N2O5 — CID 19887592
2-(1-azabicyclo[2.2.1]heptan-4-yl)-5-methyl-1,3-oxazole;oxalic acid (PubChem CID 19887592) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-(1-azabicyclo[2.2.1]heptan-4-yl)-5-methyl-1,3-oxazole;oxalic acid.
| Compound Name | 2-(1-azabicyclo[2.2.1]heptan-4-yl)-5-methyl-1,3-oxazole;oxalic acid |
|---|---|
| PubChem CID | 19887592 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-(1-azabicyclo[2.2.1]heptan-4-yl)-5-methyl-1,3-oxazole;oxalic acid |
| SMILES | Cc1cnc(C23CCN(CC2)C3)o1.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H14N2O.C2H2O4/c1-8-6-11-9(13-8)10-2-4-12(7-10)5-3-10;3-1(4)2(5)6/h6H,2-5,7H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | RZEBBXIVIXBMBT-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|