About 2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate
2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate (PubChem CID 19891100) has the molecular formula C10H18O4S4
and a molecular weight of 330.52 g/mol. Its IUPAC name is 2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate.
Molecular Properties
| Compound Name | 2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate |
| PubChem CID | 19891100 |
| Molecular Formula | C10H18O4S4 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate |
| SMILES | O=C(CCSSCCC(=O)OCCS)OCCS |
| InChI | InChI=1S/C10H18O4S4/c11-9(13-3-5-15)1-7-17-18-8-2-10(12)14-4-6-16/h15-16H,1-8H2 |
| InChIKey | VIWLSNZYUSQPIT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate?
The IUPAC name of 2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate (CID 19891100) is 2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate.
What is the SMILES notation for 2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate?
The canonical SMILES for 2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate is O=C(CCSSCCC(=O)OCCS)OCCS.
What is the InChIKey of 2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate?
The InChIKey is VIWLSNZYUSQPIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4S4/c11-9(13-3-5-15)1-7-17-18-8-2-10(12)14-4-6-16/h15-16H,1-8H2.
What are the key properties of 2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate?
2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate has a molecular weight of 330.52 g/mol, XLogP of 2.09, 11 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylethyl 3-[[3-oxo-3-(2-sulfanylethoxy)propyl]disulfanyl]propanoate is sourced from PubChem (CID 19891100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).