About 5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate
5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate (PubChem CID 21406831) has the molecular formula C13H24O4S2
and a molecular weight of 308.47 g/mol. Its IUPAC name is 5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate.
Molecular Properties
| Compound Name | 5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate |
| PubChem CID | 21406831 |
| Molecular Formula | C13H24O4S2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate |
| SMILES | O=C(CCCS)OCCCCCOC(=O)CCCS |
| InChI | InChI=1S/C13H24O4S2/c14-12(6-4-10-18)16-8-2-1-3-9-17-13(15)7-5-11-19/h18-19H,1-11H2 |
| InChIKey | ZKSMOGOTGWWQBM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate?
The IUPAC name of 5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate (CID 21406831) is 5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate.
What is the SMILES notation for 5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate?
The canonical SMILES for 5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate is O=C(CCCS)OCCCCCOC(=O)CCCS.
What is the InChIKey of 5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate?
The InChIKey is ZKSMOGOTGWWQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4S2/c14-12(6-4-10-18)16-8-2-1-3-9-17-13(15)7-5-11-19/h18-19H,1-11H2.
What are the key properties of 5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate?
5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate has a molecular weight of 308.47 g/mol, XLogP of 2.66, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-sulfanylbutanoyloxy)pentyl 4-sulfanylbutanoate is sourced from PubChem (CID 21406831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).