C11H5ClF7N3 — CID 19892779
3-chloro-2-[4-(1,1,2,2-tetrafluoroethyl)imidazol-1-yl]-5-(trifluoromethyl)pyridine (PubChem CID 19892779) has the molecular formula C11H5ClF7N3 and a molecular weight of 347.62 g/mol. Its IUPAC name is 3-chloro-2-[4-(1,1,2,2-tetrafluoroethyl)imidazol-1-yl]-5-(trifluoromethyl)pyridine.
| Compound Name | 3-chloro-2-[4-(1,1,2,2-tetrafluoroethyl)imidazol-1-yl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 19892779 |
| Molecular Formula | C11H5ClF7N3 |
| Molecular Weight | 347.62 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 3-chloro-2-[4-(1,1,2,2-tetrafluoroethyl)imidazol-1-yl]-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)C(F)(F)c1cn(-c2ncc(C(F)(F)F)cc2Cl)cn1 |
| InChI | InChI=1S/C11H5ClF7N3/c12-6-1-5(11(17,18)19)2-20-8(6)22-3-7(21-4-22)10(15,16)9(13)14/h1-4,9H |
| InChIKey | OGSIKTVAFBCJST-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|