C17H25N3OS — CID 19893371
anisole;4-methyl-5-(2-piperazin-1-ylethyl)-1,3-thiazole (PubChem CID 19893371) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is anisole;4-methyl-5-(2-piperazin-1-ylethyl)-1,3-thiazole.
| Compound Name | anisole;4-methyl-5-(2-piperazin-1-ylethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 19893371 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | anisole;4-methyl-5-(2-piperazin-1-ylethyl)-1,3-thiazole |
| SMILES | COc1ccccc1.Cc1ncsc1CCN1CCNCC1 |
| InChI | InChI=1S/C10H17N3S.C7H8O/c1-9-10(14-8-12-9)2-5-13-6-3-11-4-7-13;1-8-7-5-3-2-4-6-7/h8,11H,2-7H2,1H3;2-6H,1H3 |
| InChIKey | PPFGWZPCOHOWCL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |