C18H27N3O2S — CID 19019432
ethoxybenzene;4-methyl-5-(2-piperazin-1-ylethoxy)-1,3-thiazole (PubChem CID 19019432) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is ethoxybenzene;4-methyl-5-(2-piperazin-1-ylethoxy)-1,3-thiazole.
| Compound Name | ethoxybenzene;4-methyl-5-(2-piperazin-1-ylethoxy)-1,3-thiazole |
|---|---|
| PubChem CID | 19019432 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | ethoxybenzene;4-methyl-5-(2-piperazin-1-ylethoxy)-1,3-thiazole |
| SMILES | CCOc1ccccc1.Cc1ncsc1OCCN1CCNCC1 |
| InChI | InChI=1S/C10H17N3OS.C8H10O/c1-9-10(15-8-12-9)14-7-6-13-4-2-11-3-5-13;1-2-9-8-6-4-3-5-7-8/h8,11H,2-7H2,1H3;3-7H,2H2,1H3 |
| InChIKey | RBBZVXJPXIZDDO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |