C10H13N3O2 — CID 19894152
1-hydroxy-1-[(2-pyridin-4-ylcyclopropyl)methyl]urea (PubChem CID 19894152) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-hydroxy-1-[(2-pyridin-4-ylcyclopropyl)methyl]urea.
| Compound Name | 1-hydroxy-1-[(2-pyridin-4-ylcyclopropyl)methyl]urea |
|---|---|
| PubChem CID | 19894152 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1-hydroxy-1-[(2-pyridin-4-ylcyclopropyl)methyl]urea |
| SMILES | NC(=O)N(O)CC1CC1c1ccncc1 |
| InChI | InChI=1S/C10H13N3O2/c11-10(14)13(15)6-8-5-9(8)7-1-3-12-4-2-7/h1-4,8-9,15H,5-6H2,(H2,11,14) |
| InChIKey | OIULQGFIACAUIS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|