C18H20N2O3 — CID 22844514
1-hydroxy-1-[[(1R,2R)-2-[3-(3-methylphenoxy)phenyl]cyclopropyl]methyl]urea (PubChem CID 22844514) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-hydroxy-1-[[(1R,2R)-2-[3-(3-methylphenoxy)phenyl]cyclopropyl]methyl]urea.
| Compound Name | 1-hydroxy-1-[[(1R,2R)-2-[3-(3-methylphenoxy)phenyl]cyclopropyl]methyl]urea |
|---|---|
| PubChem CID | 22844514 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-hydroxy-1-[[(1R,2R)-2-[3-(3-methylphenoxy)phenyl]cyclopropyl]methyl]urea |
| SMILES | Cc1cccc(Oc2cccc([C@@H]3C[C@H]3CN(O)C(N)=O)c2)c1 |
| InChI | InChI=1S/C18H20N2O3/c1-12-4-2-6-15(8-12)23-16-7-3-5-13(9-16)17-10-14(17)11-20(22)18(19)21/h2-9,14,17,22H,10-11H2,1H3,(H2,19,21)/t14-,17-/m0/s1 |
| InChIKey | KCSNYONXBFICDK-YOEHRIQHSA-N |
| XLogP | 3.66 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|