C13H9Br3S — CID 19894782
2,5-dibromo-3-(1-bromo-2-phenylcyclopropyl)thiophene (PubChem CID 19894782) has the molecular formula C13H9Br3S and a molecular weight of 436.99 g/mol. Its IUPAC name is 2,5-dibromo-3-(1-bromo-2-phenylcyclopropyl)thiophene.
| Compound Name | 2,5-dibromo-3-(1-bromo-2-phenylcyclopropyl)thiophene |
|---|---|
| PubChem CID | 19894782 |
| Molecular Formula | C13H9Br3S |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 433.80 |
| IUPAC Name | 2,5-dibromo-3-(1-bromo-2-phenylcyclopropyl)thiophene |
| SMILES | Brc1cc(C2(Br)CC2c2ccccc2)c(Br)s1 |
| InChI | InChI=1S/C13H9Br3S/c14-11-6-9(12(15)17-11)13(16)7-10(13)8-4-2-1-3-5-8/h1-6,10H,7H2 |
| InChIKey | UUAQCGIIFAAKHU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|