C5H8N2O — CID 19896984
1-(1,3-oxazol-2-yl)ethanamine (PubChem CID 19896984) has the molecular formula C5H8N2O and a molecular weight of 112.13 g/mol. Its IUPAC name is 1-(1,3-oxazol-2-yl)ethanamine.
| Compound Name | 1-(1,3-oxazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 19896984 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 1-(1,3-oxazol-2-yl)ethanamine |
| SMILES | CC(N)c1ncco1 |
| InChI | InChI=1S/C5H8N2O/c1-4(6)5-7-2-3-8-5/h2-4H,6H2,1H3 |
| InChIKey | CWJDVDQXFIORGV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |