C11H12N2O2S — CID 19899614
1-[4-(hydroxyamino)-2,3-dihydro-1,5-benzothiazepin-8-yl]ethanone (PubChem CID 19899614) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 1-[4-(hydroxyamino)-2,3-dihydro-1,5-benzothiazepin-8-yl]ethanone.
| Compound Name | 1-[4-(hydroxyamino)-2,3-dihydro-1,5-benzothiazepin-8-yl]ethanone |
|---|---|
| PubChem CID | 19899614 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 1-[4-(hydroxyamino)-2,3-dihydro-1,5-benzothiazepin-8-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)SCCC(NO)=N2 |
| InChI | InChI=1S/C11H12N2O2S/c1-7(14)8-2-3-9-10(6-8)16-5-4-11(12-9)13-15/h2-3,6,15H,4-5H2,1H3,(H,12,13) |
| InChIKey | CCCWKTUZBJXRFM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|