C11H17N3 — CID 19902305
N,N-diethyl-4-imidazol-1-ylbut-2-yn-1-amine (PubChem CID 19902305) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N,N-diethyl-4-imidazol-1-ylbut-2-yn-1-amine.
| Compound Name | N,N-diethyl-4-imidazol-1-ylbut-2-yn-1-amine |
|---|---|
| PubChem CID | 19902305 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N,N-diethyl-4-imidazol-1-ylbut-2-yn-1-amine |
| SMILES | CCN(CC)CC#CCn1ccnc1 |
| InChI | InChI=1S/C11H17N3/c1-3-13(4-2)8-5-6-9-14-10-7-12-11-14/h7,10-11H,3-4,8-9H2,1-2H3 |
| InChIKey | HZXDDWPLHAVKCD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|