C23H30ClNO3S — CID 19902324
3-(2-butyl-1-benzofuran-3-yl)-5-[2-(diethylamino)ethoxy]thiophene-2-carbaldehyde;hydrochloride (PubChem CID 19902324) has the molecular formula C23H30ClNO3S and a molecular weight of 436.02 g/mol. Its IUPAC name is 3-(2-butyl-1-benzofuran-3-yl)-5-[2-(diethylamino)ethoxy]thiophene-2-carbaldehyde;hydrochloride.
| Compound Name | 3-(2-butyl-1-benzofuran-3-yl)-5-[2-(diethylamino)ethoxy]thiophene-2-carbaldehyde;hydrochloride |
|---|---|
| PubChem CID | 19902324 |
| Molecular Formula | C23H30ClNO3S |
| Molecular Weight | 436.02 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 3-(2-butyl-1-benzofuran-3-yl)-5-[2-(diethylamino)ethoxy]thiophene-2-carbaldehyde;hydrochloride |
| SMILES | CCCCc1oc2ccccc2c1-c1cc(OCCN(CC)CC)sc1C=O.Cl |
| InChI | InChI=1S/C23H29NO3S.ClH/c1-4-7-11-20-23(17-10-8-9-12-19(17)27-20)18-15-22(28-21(18)16-25)26-14-13-24(5-2)6-3;/h8-10,12,15-16H,4-7,11,13-14H2,1-3H3;1H |
| InChIKey | OOSGFSNBFDAVCM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.02 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|