C19H42N2O — CID 19902935
6-(11-methyldodecoxy)hexane-2,3-diamine (PubChem CID 19902935) has the molecular formula C19H42N2O and a molecular weight of 314.56 g/mol. Its IUPAC name is 6-(11-methyldodecoxy)hexane-2,3-diamine.
| Compound Name | 6-(11-methyldodecoxy)hexane-2,3-diamine |
|---|---|
| PubChem CID | 19902935 |
| Molecular Formula | C19H42N2O |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.33 |
| IUPAC Name | 6-(11-methyldodecoxy)hexane-2,3-diamine |
| SMILES | CC(C)CCCCCCCCCCOCCCC(N)C(C)N |
| InChI | InChI=1S/C19H42N2O/c1-17(2)13-10-8-6-4-5-7-9-11-15-22-16-12-14-19(21)18(3)20/h17-19H,4-16,20-21H2,1-3H3 |
| InChIKey | NIFGVXOWCUMTAY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|