About N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide
N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide (PubChem CID 19906205) has the molecular formula C23H24NOP
and a molecular weight of 361.43 g/mol. Its IUPAC name is N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide.
Molecular Properties
| Compound Name | N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide |
| PubChem CID | 19906205 |
| Molecular Formula | C23H24NOP |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide |
| SMILES | CCCNC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24NOP/c1-2-18-24-23(25)19-26(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,19H,2,18H2,1H3,(H,24,25) |
| InChIKey | WCEPIHBJWIROFS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide?
The IUPAC name of N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide (CID 19906205) is N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide.
What is the SMILES notation for N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide?
The canonical SMILES for N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide is CCCNC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide?
The InChIKey is WCEPIHBJWIROFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24NOP/c1-2-18-24-23(25)19-26(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,19H,2,18H2,1H3,(H,24,25).
What are the key properties of N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide?
N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide has a molecular weight of 361.43 g/mol, XLogP of 3.31, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-2-(triphenyl-λ5-phosphanylidene)acetamide is sourced from PubChem (CID 19906205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).