C19H24O5 — CID 19907970
(4-butoxy-2-hydroxy-4-methoxycyclohexa-2,5-dien-1-yl)-(3-methoxyphenyl)methanone (PubChem CID 19907970) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is (4-butoxy-2-hydroxy-4-methoxycyclohexa-2,5-dien-1-yl)-(3-methoxyphenyl)methanone.
| Compound Name | (4-butoxy-2-hydroxy-4-methoxycyclohexa-2,5-dien-1-yl)-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 19907970 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (4-butoxy-2-hydroxy-4-methoxycyclohexa-2,5-dien-1-yl)-(3-methoxyphenyl)methanone |
| SMILES | CCCCOC1(OC)C=CC(C(=O)c2cccc(OC)c2)C(O)=C1 |
| InChI | InChI=1S/C19H24O5/c1-4-5-11-24-19(23-3)10-9-16(17(20)13-19)18(21)14-7-6-8-15(12-14)22-2/h6-10,12-13,16,20H,4-5,11H2,1-3H3 |
| InChIKey | RHYKOXQXCSBQFN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|