C20H27NO2 — CID 19909929
3,3-diphenylpropan-1-ol;N-(2-methylpropyl)formamide (PubChem CID 19909929) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 3,3-diphenylpropan-1-ol;N-(2-methylpropyl)formamide.
| Compound Name | 3,3-diphenylpropan-1-ol;N-(2-methylpropyl)formamide |
|---|---|
| PubChem CID | 19909929 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 3,3-diphenylpropan-1-ol;N-(2-methylpropyl)formamide |
| SMILES | CC(C)CNC=O.OCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16O.C5H11NO/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14;1-5(2)3-6-4-7/h1-10,15-16H,11-12H2;4-5H,3H2,1-2H3,(H,6,7) |
| InChIKey | KFHUEFGVWMKJNR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|