C7H9Cl2N — CID 19910189
5,6-dichloro-5-methylcyclohexa-1,3-dien-1-amine (PubChem CID 19910189) has the molecular formula C7H9Cl2N and a molecular weight of 178.06 g/mol. Its IUPAC name is 5,6-dichloro-5-methylcyclohexa-1,3-dien-1-amine.
| Compound Name | 5,6-dichloro-5-methylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 19910189 |
| Molecular Formula | C7H9Cl2N |
| Molecular Weight | 178.06 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | 5,6-dichloro-5-methylcyclohexa-1,3-dien-1-amine |
| SMILES | CC1(Cl)C=CC=C(N)C1Cl |
| InChI | InChI=1S/C7H9Cl2N/c1-7(9)4-2-3-5(10)6(7)8/h2-4,6H,10H2,1H3 |
| InChIKey | HRASFBLSQPSZJJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.06 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|