C32H38N6O11S — CID 19913498
2-[[2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid (PubChem CID 19913498) has the molecular formula C32H38N6O11S and a molecular weight of 714.75 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19913498 |
| Molecular Formula | C32H38N6O11S |
| Molecular Weight | 714.75 g/mol |
| Exact Mass | 714.23 |
| IUPAC Name | 2-[[2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CS)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C32H38N6O11S/c33-20(12-17-14-34-21-4-2-1-3-19(17)21)28(44)35-22(9-10-26(40)41)29(45)36-23(11-16-5-7-18(39)8-6-16)30(46)38-25(15-50)31(47)37-24(32(48)49)13-27(42)43/h1-8,14,20,22-25,34,39,50H,9-13,15,33H2,(H,35,44)(H,36,45)(H,37,47)(H,38,46)(H,40,41)(H,42,43)(H,48,49) |
| InChIKey | SXBZHCZXXKRRBX-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 290.34 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.75 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|