C29H33N5O9 — CID 19947329
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid (PubChem CID 19947329) has the molecular formula C29H33N5O9 and a molecular weight of 595.61 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19947329 |
| Molecular Formula | C29H33N5O9 |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccccc1)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C29H33N5O9/c30-19(13-17-15-31-20-9-5-4-8-18(17)20)26(39)33-22(12-16-6-2-1-3-7-16)28(41)32-21(10-11-24(35)36)27(40)34-23(29(42)43)14-25(37)38/h1-9,15,19,21-23,31H,10-14,30H2,(H,32,41)(H,33,39)(H,34,40)(H,35,36)(H,37,38)(H,42,43) |
| InChIKey | LMSHXDYVOYCXPL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 241.01 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |