C17H17NO6 — CID 19914075
5-[2-[2-(furan-2-carbonyl)pyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 19914075) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is 5-[2-[2-(furan-2-carbonyl)pyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[2-[2-(furan-2-carbonyl)pyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 19914075 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 5-[2-[2-(furan-2-carbonyl)pyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(CCn2cccc2C(=O)c2ccco2)C(=O)O1 |
| InChI | InChI=1S/C17H17NO6/c1-17(2)23-15(20)11(16(21)24-17)7-9-18-8-3-5-12(18)14(19)13-6-4-10-22-13/h3-6,8,10-11H,7,9H2,1-2H3 |
| InChIKey | KAGNKMFJTGITLE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 87.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|