C19H19NO5 — CID 10914795
5-[2-(2-benzoylpyrrol-1-yl)ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 10914795) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 5-[2-(2-benzoylpyrrol-1-yl)ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[2-(2-benzoylpyrrol-1-yl)ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 10914795 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 5-[2-(2-benzoylpyrrol-1-yl)ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(CCn2cccc2C(=O)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C19H19NO5/c1-19(2)24-17(22)14(18(23)25-19)10-12-20-11-6-9-15(20)16(21)13-7-4-3-5-8-13/h3-9,11,14H,10,12H2,1-2H3 |
| InChIKey | HNQZPTZKERAGSU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|