C12H14FN3O — CID 19914668
[3-(4-fluorophenyl)-5-propan-2-yltriazol-4-yl]methanol (PubChem CID 19914668) has the molecular formula C12H14FN3O and a molecular weight of 235.26 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-5-propan-2-yltriazol-4-yl]methanol.
| Compound Name | [3-(4-fluorophenyl)-5-propan-2-yltriazol-4-yl]methanol |
|---|---|
| PubChem CID | 19914668 |
| Molecular Formula | C12H14FN3O |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | [3-(4-fluorophenyl)-5-propan-2-yltriazol-4-yl]methanol |
| SMILES | CC(C)c1nnn(-c2ccc(F)cc2)c1CO |
| InChI | InChI=1S/C12H14FN3O/c1-8(2)12-11(7-17)16(15-14-12)10-5-3-9(13)4-6-10/h3-6,8,17H,7H2,1-2H3 |
| InChIKey | BBIMKINURDQHPW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |