C23H26N2OS — CID 19919637
(E)-3-[4-[4-(2-phenylethyl)piperazin-1-yl]-1-benzothiophen-2-yl]prop-2-en-1-ol (PubChem CID 19919637) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is (E)-3-[4-[4-(2-phenylethyl)piperazin-1-yl]-1-benzothiophen-2-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[4-[4-(2-phenylethyl)piperazin-1-yl]-1-benzothiophen-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 19919637 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (E)-3-[4-[4-(2-phenylethyl)piperazin-1-yl]-1-benzothiophen-2-yl]prop-2-en-1-ol |
| SMILES | OC/C=C/c1cc2c(N3CCN(CCc4ccccc4)CC3)cccc2s1 |
| InChI | InChI=1S/C23H26N2OS/c26-17-5-8-20-18-21-22(9-4-10-23(21)27-20)25-15-13-24(14-16-25)12-11-19-6-2-1-3-7-19/h1-10,18,26H,11-17H2/b8-5+ |
| InChIKey | BEQQVNJWDNRKKI-VMPITWQZSA-N |
| XLogP | 4.27 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |