C21H27Cl2N3S — CID 19919596
[4-[4-(2-phenylethyl)piperazin-1-yl]-1-benzothiophen-2-yl]methanamine;dihydrochloride (PubChem CID 19919596) has the molecular formula C21H27Cl2N3S and a molecular weight of 424.44 g/mol. Its IUPAC name is [4-[4-(2-phenylethyl)piperazin-1-yl]-1-benzothiophen-2-yl]methanamine;dihydrochloride.
| Compound Name | [4-[4-(2-phenylethyl)piperazin-1-yl]-1-benzothiophen-2-yl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 19919596 |
| Molecular Formula | C21H27Cl2N3S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [4-[4-(2-phenylethyl)piperazin-1-yl]-1-benzothiophen-2-yl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCc1cc2c(N3CCN(CCc4ccccc4)CC3)cccc2s1 |
| InChI | InChI=1S/C21H25N3S.2ClH/c22-16-18-15-19-20(7-4-8-21(19)25-18)24-13-11-23(12-14-24)10-9-17-5-2-1-3-6-17;;/h1-8,15H,9-14,16,22H2;2*1H |
| InChIKey | QPBIWQPDIFMYBA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |