C27H27ClFN5O5S — CID 19919758
N-tert-butyl-2-[4-[[1-(2-chloro-5-nitrophenyl)-3-ethyl-5-oxo-1,2,4-triazol-4-yl]methyl]-3-fluorophenyl]benzenesulfonamide (PubChem CID 19919758) has the molecular formula C27H27ClFN5O5S and a molecular weight of 588.06 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[[1-(2-chloro-5-nitrophenyl)-3-ethyl-5-oxo-1,2,4-triazol-4-yl]methyl]-3-fluorophenyl]benzenesulfonamide.
| Compound Name | N-tert-butyl-2-[4-[[1-(2-chloro-5-nitrophenyl)-3-ethyl-5-oxo-1,2,4-triazol-4-yl]methyl]-3-fluorophenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19919758 |
| Molecular Formula | C27H27ClFN5O5S |
| Molecular Weight | 588.06 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | N-tert-butyl-2-[4-[[1-(2-chloro-5-nitrophenyl)-3-ethyl-5-oxo-1,2,4-triazol-4-yl]methyl]-3-fluorophenyl]benzenesulfonamide |
| SMILES | CCc1nn(-c2cc([N+](=O)[O-])ccc2Cl)c(=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)NC(C)(C)C)cc1F |
| InChI | InChI=1S/C27H27ClFN5O5S/c1-5-25-30-33(23-15-19(34(36)37)12-13-21(23)28)26(35)32(25)16-18-11-10-17(14-22(18)29)20-8-6-7-9-24(20)40(38,39)31-27(2,3)4/h6-15,31H,5,16H2,1-4H3 |
| InChIKey | UNXHSVJDANJVKC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.06 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|