C30H32ClN5O7S — CID 10054925
tert-butyl N-[2-[4-[[3-butyl-1-(2-chloro-5-nitrophenyl)-5-oxo-1,2,4-triazol-4-yl]methyl]phenyl]phenyl]sulfonylcarbamate (PubChem CID 10054925) has the molecular formula C30H32ClN5O7S and a molecular weight of 642.13 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[[3-butyl-1-(2-chloro-5-nitrophenyl)-5-oxo-1,2,4-triazol-4-yl]methyl]phenyl]phenyl]sulfonylcarbamate.
| Compound Name | tert-butyl N-[2-[4-[[3-butyl-1-(2-chloro-5-nitrophenyl)-5-oxo-1,2,4-triazol-4-yl]methyl]phenyl]phenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 10054925 |
| Molecular Formula | C30H32ClN5O7S |
| Molecular Weight | 642.13 g/mol |
| Exact Mass | 641.17 |
| IUPAC Name | tert-butyl N-[2-[4-[[3-butyl-1-(2-chloro-5-nitrophenyl)-5-oxo-1,2,4-triazol-4-yl]methyl]phenyl]phenyl]sulfonylcarbamate |
| SMILES | CCCCc1nn(-c2cc([N+](=O)[O-])ccc2Cl)c(=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C30H32ClN5O7S/c1-5-6-11-27-32-35(25-18-22(36(39)40)16-17-24(25)31)29(38)34(27)19-20-12-14-21(15-13-20)23-9-7-8-10-26(23)44(41,42)33-28(37)43-30(2,3)4/h7-10,12-18H,5-6,11,19H2,1-4H3,(H,33,37) |
| InChIKey | KHSVJMHKSNBGMS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.13 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|