C38H42ClN5O4S — CID 67879059
N-[2-[4-[[3-butyl-1-[2-methyl-3-(pentylamino)phenyl]-5-oxo-1,2,4-triazol-4-yl]methyl]phenyl]phenyl]sulfonyl-2-chlorobenzamide (PubChem CID 67879059) has the molecular formula C38H42ClN5O4S and a molecular weight of 700.31 g/mol. Its IUPAC name is N-[2-[4-[[3-butyl-1-[2-methyl-3-(pentylamino)phenyl]-5-oxo-1,2,4-triazol-4-yl]methyl]phenyl]phenyl]sulfonyl-2-chlorobenzamide.
| Compound Name | N-[2-[4-[[3-butyl-1-[2-methyl-3-(pentylamino)phenyl]-5-oxo-1,2,4-triazol-4-yl]methyl]phenyl]phenyl]sulfonyl-2-chlorobenzamide |
|---|---|
| PubChem CID | 67879059 |
| Molecular Formula | C38H42ClN5O4S |
| Molecular Weight | 700.31 g/mol |
| Exact Mass | 699.26 |
| IUPAC Name | N-[2-[4-[[3-butyl-1-[2-methyl-3-(pentylamino)phenyl]-5-oxo-1,2,4-triazol-4-yl]methyl]phenyl]phenyl]sulfonyl-2-chlorobenzamide |
| SMILES | CCCCCNc1cccc(-n2nc(CCCC)n(Cc3ccc(-c4ccccc4S(=O)(=O)NC(=O)c4ccccc4Cl)cc3)c2=O)c1C |
| InChI | InChI=1S/C38H42ClN5O4S/c1-4-6-12-25-40-33-17-13-18-34(27(33)3)44-38(46)43(36(41-44)20-7-5-2)26-28-21-23-29(24-22-28)30-14-9-11-19-35(30)49(47,48)42-37(45)31-15-8-10-16-32(31)39/h8-11,13-19,21-24,40H,4-7,12,20,25-26H2,1-3H3,(H,42,45) |
| InChIKey | UGJVMHZPJOLLHR-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.31 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|