C34H31Cl2N5O5S — CID 139621083
N-[5-[[3-butyl-1-[chloro-(2-phenylacetyl)amino]-5-oxo-1,2,4-triazol-4-yl]methyl]-2-phenylphenyl]sulfonyl-2-chlorobenzamide (PubChem CID 139621083) has the molecular formula C34H31Cl2N5O5S and a molecular weight of 692.63 g/mol. Its IUPAC name is N-[5-[[3-butyl-1-[chloro-(2-phenylacetyl)amino]-5-oxo-1,2,4-triazol-4-yl]methyl]-2-phenylphenyl]sulfonyl-2-chlorobenzamide.
| Compound Name | N-[5-[[3-butyl-1-[chloro-(2-phenylacetyl)amino]-5-oxo-1,2,4-triazol-4-yl]methyl]-2-phenylphenyl]sulfonyl-2-chlorobenzamide |
|---|---|
| PubChem CID | 139621083 |
| Molecular Formula | C34H31Cl2N5O5S |
| Molecular Weight | 692.63 g/mol |
| Exact Mass | 691.14 |
| IUPAC Name | N-[5-[[3-butyl-1-[chloro-(2-phenylacetyl)amino]-5-oxo-1,2,4-triazol-4-yl]methyl]-2-phenylphenyl]sulfonyl-2-chlorobenzamide |
| SMILES | CCCCc1nn(N(Cl)C(=O)Cc2ccccc2)c(=O)n1Cc1ccc(-c2ccccc2)c(S(=O)(=O)NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C34H31Cl2N5O5S/c1-2-3-18-31-37-41(40(36)32(42)22-24-12-6-4-7-13-24)34(44)39(31)23-25-19-20-27(26-14-8-5-9-15-26)30(21-25)47(45,46)38-33(43)28-16-10-11-17-29(28)35/h4-17,19-21H,2-3,18,22-23H2,1H3,(H,38,43) |
| InChIKey | NJHXINDSVDZKIT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|