C26H24F3N5O5S — CID 67835503
5-[[3-butyl-1-[4-nitro-2-(trifluoromethyl)phenyl]-5-oxo-1,2,4-triazol-4-yl]methyl]-2-phenylbenzenesulfonamide (PubChem CID 67835503) has the molecular formula C26H24F3N5O5S and a molecular weight of 575.57 g/mol. Its IUPAC name is 5-[[3-butyl-1-[4-nitro-2-(trifluoromethyl)phenyl]-5-oxo-1,2,4-triazol-4-yl]methyl]-2-phenylbenzenesulfonamide.
| Compound Name | 5-[[3-butyl-1-[4-nitro-2-(trifluoromethyl)phenyl]-5-oxo-1,2,4-triazol-4-yl]methyl]-2-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 67835503 |
| Molecular Formula | C26H24F3N5O5S |
| Molecular Weight | 575.57 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | 5-[[3-butyl-1-[4-nitro-2-(trifluoromethyl)phenyl]-5-oxo-1,2,4-triazol-4-yl]methyl]-2-phenylbenzenesulfonamide |
| SMILES | CCCCc1nn(-c2ccc([N+](=O)[O-])cc2C(F)(F)F)c(=O)n1Cc1ccc(-c2ccccc2)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C26H24F3N5O5S/c1-2-3-9-24-31-33(22-13-11-19(34(36)37)15-21(22)26(27,28)29)25(35)32(24)16-17-10-12-20(18-7-5-4-6-8-18)23(14-17)40(30,38)39/h4-8,10-15H,2-3,9,16H2,1H3,(H2,30,38,39) |
| InChIKey | CFDFZPKUKBJDGQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 143.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|