C14H19N2O2S+ — CID 19920368
N-[2-(3-oxo-2H-1,3-benzothiazol-3-ium-2-yl)ethyl]pentanamide (PubChem CID 19920368) has the molecular formula C14H19N2O2S+ and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[2-(3-oxo-2H-1,3-benzothiazol-3-ium-2-yl)ethyl]pentanamide.
| Compound Name | N-[2-(3-oxo-2H-1,3-benzothiazol-3-ium-2-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 19920368 |
| Molecular Formula | C14H19N2O2S+ |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[2-(3-oxo-2H-1,3-benzothiazol-3-ium-2-yl)ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCC1Sc2ccccc2[N+]1=O |
| InChI | InChI=1S/C14H18N2O2S/c1-2-3-8-13(17)15-10-9-14-16(18)11-6-4-5-7-12(11)19-14/h4-7,14H,2-3,8-10H2,1H3/p+1 |
| InChIKey | LMYPUJJNUWTAEO-UHFFFAOYSA-O |
| XLogP | 3.23 |
| TPSA | 49.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|