C6H16N2 — CID 19930995
1-N,1-N'-dimethylbutane-1,1-diamine (PubChem CID 19930995) has the molecular formula C6H16N2 and a molecular weight of 116.21 g/mol. Its IUPAC name is 1-N,1-N'-dimethylbutane-1,1-diamine.
| Compound Name | 1-N,1-N'-dimethylbutane-1,1-diamine |
|---|---|
| PubChem CID | 19930995 |
| Molecular Formula | C6H16N2 |
| Molecular Weight | 116.21 g/mol |
| Exact Mass | 116.13 |
| IUPAC Name | 1-N,1-N'-dimethylbutane-1,1-diamine |
| SMILES | CCCC(NC)NC |
| InChI | InChI=1S/C6H16N2/c1-4-5-6(7-2)8-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | JOVPWMDTOGQRIZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|