C14H12F5N3OS — CID 19931958
N,N-diethyl-3-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazole-1-carboxamide (PubChem CID 19931958) has the molecular formula C14H12F5N3OS and a molecular weight of 365.33 g/mol. Its IUPAC name is N,N-diethyl-3-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazole-1-carboxamide.
| Compound Name | N,N-diethyl-3-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazole-1-carboxamide |
|---|---|
| PubChem CID | 19931958 |
| Molecular Formula | C14H12F5N3OS |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N,N-diethyl-3-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazole-1-carboxamide |
| SMILES | CCN(CC)C(=O)n1ccc(Sc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C14H12F5N3OS/c1-3-21(4-2)14(23)22-6-5-7(20-22)24-13-11(18)9(16)8(15)10(17)12(13)19/h5-6H,3-4H2,1-2H3 |
| InChIKey | ZHZZVYUOXGRSMX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|