About diaminoazanium;methyl sulfate
diaminoazanium;methyl sulfate (PubChem CID 19938823) has the molecular formula CH9N3O4S
and a molecular weight of 159.17 g/mol. Its IUPAC name is diaminoazanium;methyl sulfate.
Molecular Properties
| Compound Name | diaminoazanium;methyl sulfate |
| PubChem CID | 19938823 |
| Molecular Formula | CH9N3O4S |
| Molecular Weight | 159.17 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | diaminoazanium;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].N[NH2+]N |
| InChI | InChI=1S/CH4O4S.H5N3/c1-5-6(2,3)4;1-3-2/h1H3,(H,2,3,4);3H,1-2H2 |
| InChIKey | ZTWZQQUHYUAWRS-UHFFFAOYSA-N |
| XLogP | -3.61 |
| TPSA | 135.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.17 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze diaminoazanium;methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diaminoazanium;methyl sulfate?
The IUPAC name of diaminoazanium;methyl sulfate (CID 19938823) is diaminoazanium;methyl sulfate.
What is the SMILES notation for diaminoazanium;methyl sulfate?
The canonical SMILES for diaminoazanium;methyl sulfate is COS(=O)(=O)[O-].N[NH2+]N.
What is the InChIKey of diaminoazanium;methyl sulfate?
The InChIKey is ZTWZQQUHYUAWRS-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4O4S.H5N3/c1-5-6(2,3)4;1-3-2/h1H3,(H,2,3,4);3H,1-2H2.
What are the key properties of diaminoazanium;methyl sulfate?
diaminoazanium;methyl sulfate has a molecular weight of 159.17 g/mol, XLogP of -3.61, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diaminoazanium;methyl sulfate is sourced from PubChem (CID 19938823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).