C36H47N5O5S — CID 19939774
butyl N-[2-[4-[[6-(butanoylamino)-7-methyl-2-propylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]-4-butylphenyl]sulfonylcarbamate (PubChem CID 19939774) has the molecular formula C36H47N5O5S and a molecular weight of 661.87 g/mol. Its IUPAC name is butyl N-[2-[4-[[6-(butanoylamino)-7-methyl-2-propylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]-4-butylphenyl]sulfonylcarbamate.
| Compound Name | butyl N-[2-[4-[[6-(butanoylamino)-7-methyl-2-propylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]-4-butylphenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 19939774 |
| Molecular Formula | C36H47N5O5S |
| Molecular Weight | 661.87 g/mol |
| Exact Mass | 661.33 |
| IUPAC Name | butyl N-[2-[4-[[6-(butanoylamino)-7-methyl-2-propylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]-4-butylphenyl]sulfonylcarbamate |
| SMILES | CCCCOC(=O)NS(=O)(=O)c1ccc(CCCC)cc1-c1ccc(Cn2c(CCC)nc3c(C)c(NC(=O)CCC)cnc32)cc1 |
| InChI | InChI=1S/C36H47N5O5S/c1-6-10-14-26-17-20-31(47(44,45)40-36(43)46-21-11-7-2)29(22-26)28-18-15-27(16-19-28)24-41-32(12-8-3)39-34-25(5)30(23-37-35(34)41)38-33(42)13-9-4/h15-20,22-23H,6-14,21,24H2,1-5H3,(H,38,42)(H,40,43) |
| InChIKey | UBCCQXWYZURAAO-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.87 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|