C31H37FN4O4S — CID 19939731
butyl N-[2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-3-fluorophenyl]-4-propylphenyl]sulfonylcarbamate (PubChem CID 19939731) has the molecular formula C31H37FN4O4S and a molecular weight of 580.73 g/mol. Its IUPAC name is butyl N-[2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-3-fluorophenyl]-4-propylphenyl]sulfonylcarbamate.
| Compound Name | butyl N-[2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-3-fluorophenyl]-4-propylphenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 19939731 |
| Molecular Formula | C31H37FN4O4S |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | butyl N-[2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-3-fluorophenyl]-4-propylphenyl]sulfonylcarbamate |
| SMILES | CCCCOC(=O)NS(=O)(=O)c1ccc(CCC)cc1-c1ccc(Cn2c(CC)nc3c(C)cc(C)nc32)c(F)c1 |
| InChI | InChI=1S/C31H37FN4O4S/c1-6-9-15-40-31(37)35-41(38,39)27-14-11-22(10-7-2)17-25(27)23-12-13-24(26(32)18-23)19-36-28(8-3)34-29-20(4)16-21(5)33-30(29)36/h11-14,16-18H,6-10,15,19H2,1-5H3,(H,35,37) |
| InChIKey | GBKXYZOUTRCUPU-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|