C21H29N5O5S — CID 19943805
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]amino]-3-methylbutanoic acid (PubChem CID 19943805) has the molecular formula C21H29N5O5S and a molecular weight of 463.56 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 19943805 |
| Molecular Formula | C21H29N5O5S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)CNC(=O)C(CS)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C21H29N5O5S/c1-11(2)18(21(30)31)26-17(27)9-24-20(29)16(10-32)25-19(28)14(22)7-12-8-23-15-6-4-3-5-13(12)15/h3-6,8,11,14,16,18,23,32H,7,9-10,22H2,1-2H3,(H,24,29)(H,25,28)(H,26,27)(H,30,31) |
| InChIKey | NTLFRNMFXMMTPY-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 166.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|